| HWiNFO32 v5.84-3450 |
| Creation Time | 09.07.2018 22:17 |
| DESKTOP-DPV7EO6 |
| [Current Computer] | ||
| Computer Name: | DESKTOP-DPV7EO6 | |
| Computer Brand Name: | DELL Inspiron 1121 | |
| [Operating System] | ||
| Operating System: | Microsoft Windows 10 Professional Build 16299.125 (1709/RS3) | |
| UEFI Boot: | Not Present | |
| Secure Boot: | Not Present | |
| Central Processor(s) |
| [CPU Unit Count] | ||
| Number Of Processor Packages (Physical): | 1 | |
| Number Of Processor Cores: | 2 | |
| Number Of Logical Processors: | 4 | |
| Intel Core i3-330UM |
| [General Information] | ||
| Processor Name: | Intel Core i3-330UM | |
| Original Processor Frequency: | 1200.0 MHz | |
| Original Processor Frequency [MHz]: | 1200 | |
| CPU ID: | 00020655 | |
| CPU Brand Name: | Intel(R) Core(TM) i3 CPU U 330 @ 1.20GHz | |
| CPU Vendor: | GenuineIntel | |
| CPU Stepping: | K0 | |
| CPU Code Name: | Arrandale Trans. ULV | |
| CPU Technology: | 32 nm | |
| CPU S-Spec: | SLBUG | |
| CPU Thermal Design Power (TDP): | 11.0 W | |
| CPU Thermal Design Current (TDC): | 11.0 A | |
| CPU Max. Junction Temperature (Tj,max): | 105 °C | |
| CPU Type: | Production Unit | |
| CPU Platform: | SGA | |
| Microcode Update Revision: | 4 | |
| Number of CPU Cores: | 2 | |
| Number of Logical CPUs: | 4 | |
| [Operating Points] | ||
| CPU LFM (Minimum): | 666.7 MHz = 5 x 133.3 MHz | |
| CPU HFM (Base): | 1200.0 MHz = 9 x 133.3 MHz | |
| CPU Turbo Max: | 1200.0 MHz = 9 x 133.3 MHz [Locked] | |
| CPU Current: | 1197.4 MHz = 9 x 133.0 MHz | |
| Uncore Current: | 1596.6 MHz = 12.00 x 133.0 MHz | |
| CPU Internal Bus Type: | Intel QuickPath Interconnect (QPI) v1.0 | |
| Number of QPI Links per CPU: | 1 | |
| Maximum Supported QPI Link Clock: | 1600 MHz (3.20 GT/s) | |
| Current QPI Link Clock: | 1596 MHz (3.19 GT/s) | |
| CPU External Bus Type: | Intel Direct Media Interface (DMI) v1.0 | |
| Maximum DMI Link Speed: | 2.5 GT/s | |
| Current DMI Link Speed: | 2.5 GT/s | |
| [Cache and TLB] | ||
| L1 Cache: | Instruction: 2 x 32 KBytes, Data: 2 x 32 KBytes | |
| L2 Cache: | Integrated: 2 x 256 KBytes | |
| L3 Cache: | 3 MBytes | |
| Instruction TLB: | 2MB/4MB Pages, Fully associative, 7 entries | |
| Data TLB: | 4 KB Pages, 4-way set associative, 64 entries | |
| [Standard Feature Flags] | ||
| FPU on Chip | Present | |
| Enhanced Virtual-86 Mode | Present | |
| I/O Breakpoints | Present | |
| Page Size Extensions | Present | |
| Time Stamp Counter | Present | |
| Pentium-style Model Specific Registers | Present | |
| Physical Address Extension | Present | |
| Machine Check Exception | Present | |
| CMPXCHG8B Instruction | Present | |
| APIC On Chip / PGE (AMD) | Present | |
| Fast System Call | Present | |
| Memory Type Range Registers | Present | |
| Page Global Feature | Present | |
| Machine Check Architecture | Present | |
| CMOV Instruction | Present | |
| Page Attribute Table | Present | |
| 36-bit Page Size Extensions | Present | |
| Processor Number | Not Present | |
| CLFLUSH Instruction | Present | |
| Debug Trace and EMON Store | Present | |
| Internal ACPI Support | Present | |
| MMX Technology | Present | |
| Fast FP Save/Restore (IA MMX-2) | Present | |
| Streaming SIMD Extensions | Present | |
| Streaming SIMD Extensions 2 | Present | |
| Self-Snoop | Present | |
| Multi-Threading Capable | Present | |
| Automatic Clock Control | Present | |
| IA-64 Processor | Not Present | |
| Signal Break on FERR | Present | |
| Virtual Machine Extensions (VMX) | Present | |
| Safer Mode Extensions (Intel TXT) | Not Present | |
| Streaming SIMD Extensions 3 | Present | |
| Supplemental Streaming SIMD Extensions 3 | Present | |
| Streaming SIMD Extensions 4.1 | Present | |
| Streaming SIMD Extensions 4.2 | Present | |
| AVX Support | Not Present | |
| Fused Multiply Add (FMA) | Not Present | |
| Carryless Multiplication (PCLMULQDQ)/GFMUL | Not Present | |
| CMPXCHG16B Support | Present | |
| MOVBE Instruction | Not Present | |
| POPCNT Instruction | Present | |
| XSAVE/XRSTOR/XSETBV/XGETBV Instructions | Not Present | |
| XGETBV/XSETBV OS Enabled | Not Present | |
| Float16 Instructions | Not Present | |
| AES Cryptography Support | Not Present | |
| Random Number Read Instruction (RDRAND) | Not Present | |
| Extended xAPIC | Not Present | |
| MONITOR/MWAIT Support | Present | |
| Thermal Monitor 2 | Present | |
| Enhanced SpeedStep Technology | Present | |
| L1 Context ID | Not Present | |
| Send Task Priority Messages Disabling | Present | |
| Processor Context ID | Present | |
| Direct Cache Access | Not Present | |
| TSC-deadline Timer | Not Present | |
| Performance/Debug Capability MSR | Present | |
| IA32 Debug Interface Support | Not Present | |
| 64-Bit Debug Store | Present | |
| CPL Qualified Debug Store | Present | |
| [Extended Feature Flags] | ||
| 64-bit Extensions | Present | |
| RDTSCP and TSC_AUX Support | Present | |
| 1 GB large page support | Not Present | |
| No Execute | Present | |
| SYSCALL/SYSRET Support | Not Present | |
| Bit Manipulation Instructions Set 1 | Not Present | |
| Bit Manipulation Instructions Set 2 | Not Present | |
| Advanced Vector Extensions 2 (AVX2) | Not Present | |
| Advanced Vector Extensions 512 (AVX-512) | Not Present | |
| AVX-512 Prefetch Instructions | Not Present | |
| AVX-512 Exponential and Reciprocal Instructions | Not Present | |
| AVX-512 Conflict Detection Instructions | Not Present | |
| AVX-512 Doubleword and Quadword Instructions | Not Present | |
| AVX-512 Byte and Word Instructions | Not Present | |
| AVX-512 Vector Length Extensions | Not Present | |
| AVX-512 52-bit Integer FMA Instructions | Not Present | |
| Secure Hash Algorithm (SHA) Extensions | Not Present | |
| Software Guard Extensions (SGX) Support | Not Present | |
| Supervisor Mode Execution Protection (SMEP) | Not Present | |
| Supervisor Mode Access Prevention (SMAP) | Not Present | |
| Hardware Lock Elision (HLE) | Not Present | |
| Restricted Transactional Memory (RTM) | Not Present | |
| Memory Protection Extensions (MPX) | Not Present | |
| Read/Write FS/GS Base Instructions | Not Present | |
| Enhanced Performance String Instruction | Not Present | |
| INVPCID Instruction | Not Present | |
| RDSEED Instruction | Not Present | |
| Multi-precision Add Carry Instructions (ADX) | Not Present | |
| PCOMMIT Instructions | Not Present | |
| CLFLUSHOPT Instructions | Not Present | |
| CLWB Instructions | Not Present | |
| TSC_THREAD_OFFSET | Not Present | |
| Platform Quality of Service Monitoring (PQM) | Not Present | |
| Platform Quality of Service Enforcement (PQE) | Not Present | |
| FPU Data Pointer updated only on x87 Exceptions | Not Present | |
| Deprecated FPU CS and FPU DS | Not Present | |
| Intel Processor Trace | Not Present | |
| PREFETCHWT1 Instruction | Not Present | |
| AVX-512 Vector Bit Manipulation Instructions | Not Present | |
| AVX-512 Vector Bit Manipulation Instructions 2 | Not Present | |
| AVX-512 Galois Fields New Instructions | Not Present | |
| AVX-512 Vector AES | Not Present | |
| AVX-512 Vector Neural Network Instructions | Not Present | |
| AVX-512 Bit Algorithms | Not Present | |
| AVX-512 Carry-Less Multiplication Quadword (VPCLMULQDQ) | Not Present | |
| AVX-512 Vector POPCNT (VPOPCNTD/VPOPCNTQ) | Not Present | |
| User-Mode Instruction Prevention | Not Present | |
| Protection Keys for User-mode Pages | Not Present | |
| OS Enabled Protection Keys | Not Present | |
| Wait and Pause Enhancements (WAITPKG) | Not Present | |
| Total Memory Encryption | Not Present | |
| Read Processor ID | Not Present | |
| Cache Line Demote | Not Present | |
| MOVDIRI: Direct Stores | Not Present | |
| MOVDIR64B: Direct Stores | Not Present | |
| SGX Launch Configuration | Not Present | |
| AVX-512 4 x Vector Neural Network Instructions Word Variable Precision | Not Present | |
| AVX-512 4 x Fused Multiply Accumulation Packed Single Precision | Not Present | |
| Fast Short REP MOV | Not Present | |
| Platform Configuration (PCONFIG) | Not Present | |
| [Enhanced Features] | ||
| Thermal Monitor 1: | Supported, Enabled | |
| Thermal Monitor 2: | Supported, Enabled | |
| Enhanced Intel SpeedStep (GV3): | Supported, Enabled | |
| Bi-directional PROCHOT#: | N/A | |
| Extended Auto-HALT State C1E: | Enabled | |
| MLC Streamer Prefetcher | Supported, Enabled | |
| MLC Spatial Prefetcher | Supported, Enabled | |
| DCU Streamer Prefetcher | Supported, Enabled | |
| DCU IP Prefetcher | Supported, Enabled | |
| Intel Dynamic Acceleration (IDA) Technology: | Not Supported | |
| Intel Dynamic FSB Switching: | Not Supported | |
| Intel Turbo Boost Technology: | Not Supported | |
| Programmable Ratio Limits: | Not Supported | |
| Programmable TDC/TDP Limits: | Supported, Disabled | |
| Hardware Duty Cycling: | Not Supported | |
| [CPU Ironlake GMCH Features] | ||
| CPU Package Type: | SGA | |
| MCH Turbo: | Enabled | |
| VT-d: | Not Supported | |
| Secondary PEG Port: | Not Supported | |
| 2 DIMMS per Channel: | Not Supported | |
| ECC: | Not Supported | |
| DRAM ECC Forced: | Disabled | |
| Internal Graphics: | Supported | |
| DDR3 Frequency Support: | 400 MHz (DDR3-800) | |
| [Memory Ranges] | ||
| Maximum Physical Address Size: | 36-bit (64 GBytes) | |
| Maximum Virtual Address Size: | 48-bit (256 TBytes) | |
| [MTRRs] | ||
| Range 0-80000000 (0MB-2048MB) Type: | Write Back (WB) | |
| Range FFE00000-100000000 (4094MB-4096MB) Type: | Write Protected (WP) | |
| Range 80000000-C0000000 (2048MB-3072MB) Type: | Write Back (WB) | |
| Range BC000000-C0000000 (3008MB-3072MB) Type: | Uncacheable (UC) | |
| Range BB800000-BC000000 (3000MB-3008MB) Type: | Uncacheable (UC) | |
| Range 100000000-140000000 (4096MB-5120MB) Type: | Write Back (WB) | |
| Range 138000000-140000000 (4992MB-5120MB) Type: | Uncacheable (UC) | |
| Motherboard |
| [Computer] | ||
| Computer Brand Name: | DELL Inspiron 1121 | |
| [Motherboard] | ||
| Motherboard Model: | DELL 0K039P | |
| Motherboard Chipset: | Intel HM57 (IbexPeak-M DH) | |
| Motherboard Slots: | 6xPCI Express x1, 2xPCI Express x16 | |
| PCI Express Version Supported: | v1.1 | |
| USB Version Supported: | v2.0 | |
| [PCH Features] | ||
| Intel Identity Protection Technology: | Supported | |
| USB 2.0 Ports 6 and 7: | Supported | |
| PCI Express Ports 7 and 8: | Supported | |
| FIS Based Port Multiplier: | Supported | |
| SATA Ports 2 and 3: | Supported | |
| SATA RAID 0/1/5/10: | Supported | |
| [BIOS] | ||
| BIOS Manufacturer: | Insyde Software | |
| BIOS Date: | 11/15/2010 | |
| BIOS Version: | A01 | |
| UEFI BIOS: | Capable | |
| Super-IO/LPC Chip: | Unknown | |
| ACPI Devices |
| PS/2 Compatible Mouse |
| Device Name: | PS/2 Compatible Mouse | |
| [Assigned Resources] | ||
| IRQ: | 12 | |
| [Alternative 1] | ||
| IRQ: | 12 | |
| Legacy device |
| Device Name: | Legacy device | |
| [Assigned Resources] | ||
| Memory Location: | FF000000 - FFFFFFFF | |
| [Alternative 1] | ||
| Memory Location: | FF000000 - FFFFFFFF | |
| Programmable interrupt controller |
| Device Name: | Programmable interrupt controller | |
| [Assigned Resources] | ||
| I/O Port: | 0020 - 0021 | |
| I/O Port: | 0024 - 0025 | |
| I/O Port: | 0028 - 0029 | |
| I/O Port: | 002C - 002D | |
| I/O Port: | 0030 - 0031 | |
| I/O Port: | 0034 - 0035 | |
| I/O Port: | 0038 - 0039 | |
| I/O Port: | 003C - 003D | |
| I/O Port: | 00A0 - 00A1 | |
| I/O Port: | 00A4 - 00A5 | |
| I/O Port: | 00A8 - 00A9 | |
| I/O Port: | 00AC - 00AD | |
| I/O Port: | 00B0 - 00B1 | |
| I/O Port: | 00B4 - 00B5 | |
| I/O Port: | 00B8 - 00B9 | |
| I/O Port: | 00BC - 00BD | |
| I/O Port: | 04D0 - 04D1 | |
| [Alternative 1] | ||
| I/O Port: | 0020 - 0021 | |
| I/O Port: | 0024 - 0025 | |
| I/O Port: | 0028 - 0029 | |
| I/O Port: | 002C - 002D | |
| I/O Port: | 0030 - 0031 | |
| I/O Port: | 0034 - 0035 | |
| I/O Port: | 0038 - 0039 | |
| I/O Port: | 003C - 003D | |
| I/O Port: | 00A0 - 00A1 | |
| I/O Port: | 00A4 - 00A5 | |
| I/O Port: | 00A8 - 00A9 | |
| I/O Port: | 00AC - 00AD | |
| I/O Port: | 00B0 - 00B1 | |
| I/O Port: | 00B4 - 00B5 | |
| I/O Port: | 00B8 - 00B9 | |
| I/O Port: | 00BC - 00BD | |
| I/O Port: | 04D0 - 04D1 | |
| System timer |
| Device Name: | System timer | |
| [Assigned Resources] | ||
| I/O Port: | 0040 - 0043 | |
| I/O Port: | 0050 - 0053 | |
| IRQ: | 0 | |
| [Alternative 1] | ||
| I/O Port: | 0040 - 0043 | |
| I/O Port: | 0050 - 0053 | |
| IRQ: | 0 | |
| High precision event timer |
| Device Name: | High precision event timer | |
| [Assigned Resources] | ||
| Memory Location: | FED00000 - FED003FF | |
| [Alternative 1] | ||
| Memory Location: | FED00000 - FED003FF | |
| Direct memory access controller |
| Device Name: | Direct memory access controller | |
| [Assigned Resources] | ||
| I/O Port: | 0000 - 001F | |
| I/O Port: | 0081 - 0091 | |
| I/O Port: | 0093 - 009F | |
| I/O Port: | 00C0 - 00DF | |
| DMA: | 4 | |
| [Alternative 1] | ||
| I/O Port: | 0000 - 001F | |
| I/O Port: | 0081 - 0091 | |
| I/O Port: | 0093 - 009F | |
| I/O Port: | 00C0 - 00DF | |
| DMA: | 4 | |
| Standard PS/2 Keyboard |
| Device Name: | Standard PS/2 Keyboard | |
| [Assigned Resources] | ||
| I/O Port: | 0060 | |
| I/O Port: | 0064 | |
| IRQ: | 1 | |
| [Alternative 1] | ||
| I/O Port: | 0060 | |
| I/O Port: | 0064 | |
| IRQ: | 1 | |
| PCI Bus |
| Device Name: | PCI Bus | |
| [Assigned Resources] | ||
| [Alternative 1] | ||
| PCI Express Root Complex |
| Device Name: | PCI Express Root Complex | |
| [Assigned Resources] | ||
| I/O Port: | 0000 - 0CF7 | |
| I/O Port: | 0D00 - FFFF | |
| Memory Location: | 000A0000 - 000BFFFF | |
| Memory Location: | C0000000 - FEAFFFFF | |
| [Alternative 1] | ||
| I/O Port: | 0000 - 0CF7 | |
| I/O Port: | 0D00 - FFFF | |
| Memory Location: | 000A0000 - 000BFFFF | |
| Memory Location: | C0000000 - FEAFFFFF | |
| System CMOS/real time clock |
| Device Name: | System CMOS/real time clock | |
| [Assigned Resources] | ||
| I/O Port: | 0070 - 0077 | |
| IRQ: | 8 | |
| [Alternative 1] | ||
| I/O Port: | 0070 - 0077 | |
| IRQ: | 8 | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| Memory Location: | FED1C000 - FED1FFFF | |
| Memory Location: | FED10000 - FED13FFF | |
| Memory Location: | FED18000 - FED18FFF | |
| Memory Location: | FED19000 - FED19FFF | |
| Memory Location: | E0000000 - EFFFFFFF | |
| Memory Location: | FED20000 - FED3FFFF | |
| Memory Location: | FF000000 - FFFFFFFF | |
| Memory Location: | FEE00000 - FEEFFFFF | |
| Memory Location: | D0700000 - D0700FFF | |
| [Alternative 1] | ||
| Memory Location: | FED1C000 - FED1FFFF | |
| Memory Location: | FED10000 - FED13FFF | |
| Memory Location: | FED18000 - FED18FFF | |
| Memory Location: | FED19000 - FED19FFF | |
| Memory Location: | E0000000 - EFFFFFFF | |
| Memory Location: | FED20000 - FED3FFFF | |
| Memory Location: | FF000000 - FFFFFFFF | |
| Memory Location: | FEE00000 - FEEFFFFF | |
| Memory Location: | D0700000 - D0700FFF | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| I/O Port: | 002E - 002F | |
| I/O Port: | 004E - 004F | |
| I/O Port: | 0061 | |
| I/O Port: | 0063 | |
| I/O Port: | 0065 | |
| I/O Port: | 0067 | |
| I/O Port: | 0070 | |
| I/O Port: | 0080 | |
| I/O Port: | 0092 | |
| I/O Port: | 00B2 - 00B3 | |
| I/O Port: | 0680 - 069F | |
| I/O Port: | 0800 - 080F | |
| I/O Port: | 0810 - 0813 | |
| I/O Port: | FFFF | |
| I/O Port: | 0400 - 047F | |
| I/O Port: | 0500 - 057F | |
| I/O Port: | 164E - 164F | |
| I/O Port: | FF2C - FF2F | |
| [Alternative 1] | ||
| I/O Port: | 002E - 002F | |
| I/O Port: | 004E - 004F | |
| I/O Port: | 0061 | |
| I/O Port: | 0063 | |
| I/O Port: | 0065 | |
| I/O Port: | 0067 | |
| I/O Port: | 0070 | |
| I/O Port: | 0080 | |
| I/O Port: | 0092 | |
| I/O Port: | 00B2 - 00B3 | |
| I/O Port: | 0680 - 069F | |
| I/O Port: | 0800 - 080F | |
| I/O Port: | 0810 - 0813 | |
| I/O Port: | FFFF | |
| I/O Port: | 0400 - 047F | |
| I/O Port: | 0500 - 057F | |
| I/O Port: | 164E - 164F | |
| I/O Port: | FF2C - FF2F | |
| Numeric data processor |
| Device Name: | Numeric data processor | |
| [Assigned Resources] | ||
| I/O Port: | 00F0 | |
| IRQ: | 13 | |
| [Alternative 1] | ||
| I/O Port: | 00F0 | |
| IRQ: | 13 | |
| Microsoft ACPI-Compliant Embedded Controller |
| Device Name: | Microsoft ACPI-Compliant Embedded Controller | |
| [Assigned Resources] | ||
| I/O Port: | 0062 | |
| I/O Port: | 0066 | |
| [Alternative 1] | ||
| I/O Port: | 0062 | |
| I/O Port: | 0066 | |
| SMBIOS DMI |
| BIOS |
| BIOS Vendor: | Dell Inc. | |
| BIOS Version: | A01 | |
| BIOS Release Date: | 11/15/2010 | |
| BIOS Start Segment: | 0 | |
| BIOS Size: | 2048 KBytes | |
| Embedded Controller Firmware Version: | 1.1 | |
| ISA Support: | Not Present | |
| MCA Support: | Not Present | |
| EISA Support: | Not Present | |
| PCI Support: | Present | |
| PC Card (PCMCIA) Support: | Not Present | |
| Plug-and-Play Support: | Present | |
| APM Support: | Not Present | |
| Flash BIOS: | Present | |
| BIOS Shadow: | Present | |
| VL-VESA Support: | Not Present | |
| ESCD Support: | Present | |
| Boot from CD: | Present | |
| Selectable Boot: | Present | |
| BIOS ROM Socketed: | Not Present | |
| Boot from PC Card: | Not Present | |
| EDD Support: | Present | |
| NEC PC-98 Support: | Not Present | |
| ACPI Support: | Present | |
| USB Legacy Support: | Present | |
| AGP Support: | Not Present | |
| I2O Boot Support: | Not Present | |
| LS-120 Boot Support: | Not Present | |
| ATAPI ZIP Drive Boot Support: | Not Present | |
| IEE1394 Boot Support: | Not Present | |
| Smart Battery Support: | Present | |
| BIOS Boot Specification Support: | Present | |
| Function key-initiated Network Service Boot Support: | Present | |
| Targeted Content Distribution Support: | Present | |
| UEFI Specification Support: | Not Present | |
| Virtual Machine: | Not Present |
| System |
| System Manufacturer: | Dell Inc. | |
| Product Name: | Inspiron 1121 | |
| Product Version: | A01 | |
| Product Serial Number: | 3X336R1 | |
| UUID: | {4C4C4544-0058-3310-8033-B3C04F365231} | |
| SKU Number: | xxx123x#ABA | |
| Family: | 103C_5335KV |
| Mainboard |
| Mainboard Manufacturer: | Dell Inc. | |
| Mainboard Name: | 0K039P | |
| Mainboard Version: | A01 | |
| Mainboard Serial Number: | .3X336R1.CN129611BB0B58. | |
| Asset Tag: | Unknown | |
| Location in chassis: | Base Board Chassis Location |
| System Enclosure |
| Manufacturer: | Dell Inc. | |
| Case Type: | Portable | |
| Version: | N/A | |
| Serial Number: | 3X336R1 | |
| Asset Tag Number: | Unknown |
| On Board Device |
| Device Description: | Intel Video Graphics Controller | |
| Device Type: | Video Adapter | |
| Device Status: | Enabled | |
| OEM Strings |
| Dell System | ||
| 1[0471] | ||
| String3 for Original Equipment Manufacturer | ||
| String4 for Original Equipment Manufacturer | ||
| Calpella.03.59.53.1053.0012_D01.0220 |
| System Configuration Options |
| String1 for Type12 Equipment Manufacturer | ||
| String2 for Type12 Equipment Manufacturer | ||
| String3 for Type12 Equipment Manufacturer | ||
| String4 for Type12 Equipment Manufacturer |
| BIOS Language |
| English <Active> |
| System Event Log |
| Built-in Pointing Device |
| Device Type: | Touch Pad | |
| Interface Type: | Bus mouse | |
| Number of Buttons: | 2 |
| Voltage Probe |
| Description: | Voltage Probe | |
| Location: | Processor | |
| Status: | OK | |
| Maximum Value: | Unknown | |
| Minimum Value: | Unknown | |
| Resolution: | Unknown | |
| Tolerance: | Unknown | |
| Accuracy: | Unknown |
| Cooling Device |
| Type: | Fan | |
| Status: | OK | |
| Nominal Speed: | 0 RPM |
| Temperature Probe |
| Description: | Temperature Probe | |
| Location: | Processor | |
| Status: | OK | |
| Maximum Value: | Unknown | |
| Minimum Value: | Unknown | |
| Resolution: | Unknown | |
| Tolerance: | Unknown | |
| Accuracy: | Unknown |
| Electrical Current Probe |
| Description: | Electrical Current Probe | |
| Location: | Processor | |
| Status: | OK | |
| Maximum Value: | Unknown | |
| Minimum Value: | Unknown | |
| Resolution: | Unknown | |
| Tolerance: | Unknown | |
| Accuracy: | Unknown |
| System Boot Information |
| Boot Status: | No error occured |
| IPMI |
| IPMI Interface Type: | Unknown | |
| IPMI Specification Version: | 2.0 | |
| I2C Slave Address: | 0h | |
| Base Address: | Mem 000000000 |
| Additional Information |
| On Board Device |
| Device Description: | Hanksville Gbe Lan Connection | |
| Device Type: | Ethernet Adapter | |
| Device Status: | Enabled | |
| Portable Battery |
| Battery Location: | Sys. Battery Bay | |
| Battery Manufacturer: | SMP | |
| Manufacture Date: | Unknown | |
| Serial Number: | Unknown | |
| Device Name: | DELL D555173 | |
| Device Chemistry: | Lithium-ion | |
| Design Capacity: | 56000 mWh | |
| Design Voltage: | 11100 mV | |
| SBDS Verison Number: | 1.0 | |
| Max. Error in Battery Data: | 100 | |
| SBDS Serial Number: | 1 | |
| SBDS Manufacture Date: | 1/1/25 | |
| SBDS Device Chemistry: | LION |
| Intel ASF |
| Intel ASF Status: | Enabled |
| Intel AMT |
| Intel AMT Support: | Supported | |
| Intel AMT Status: | Enabled | |
| IDE-R Status: | Enabled | |
| SOL Status: | Enabled | |
| Network Interface: | Enabled |
| Intel vPro |
| CPU VT-x Support: | Supported | |
| CPU VT-x Status: | Disabled | |
| CPU VT-x2 Support: | Not Supported | |
| CPU VT-x2 Status: | Disabled | |
| CPU TXT Support: | Not Supported | |
| CPU TXT Status: | Disabled | |
| CPU VMX Status: | Enabled | |
| CPU SMX Status: | Disabled | |
| Intel ME Status: | Enabled | |
| Intel OST Firmware Support: | Not Supported | |
| Intel ASF Firmware Support: | Not Supported | |
| Intel AMT Pro Firmware Support: | Not Supported | |
| Intel AMT Basic Firmware Support: | Not Supported | |
| Intel TPM Firmware Support: | Not Supported | |
| Intel Castle Peak Support: | Not Supported | |
| Intel WoX Support: | Not Supported | |
| Intel Virtualization Engine Support: | Not Supported | |
| Intel Anti-Theft Technology Support: | Not Supported | |
| TPM On-board: | Not Supported | |
| Intel Anti-Theft Technology Enrolled: | Not Supported | |
| Intel ME Version: | v6.0, Build 1208, Hotfix 31 | |
| BIOS VT-x Support: | Not Supported | |
| BIOS VT-d Support: | Supported | |
| BIOS TXT Support: | Supported | |
| BIOS TPM Support: | Supported | |
| BIOS ME Support: | Supported | |
| BIOS VA Extensions Support: | Not Supported | |
| Intel AT PBA For Recovery Support: | Supported | |
| Intel AT WWAN Support: | Not Supported |
| Processor |
| Processor Manufacturer: | Intel(R) Corporation | |
| Processor Version: | Intel(R) Core(TM) i3 CPU U 330 @ 1.20GHz | |
| External Clock: | 1066 MHz | |
| Maximum Clock Supported: | 1200 MHz | |
| Current Clock: | 1194 MHz | |
| CPU Socket: | Populated | |
| CPU Status: | Enabled | |
| Processor Type: | Central Processor | |
| Processor Upgrade: | ZIF | |
| Socket Designation: | CPU |
| L3 Cache |
| Socket Designation: | L3 Cache | |
| Cache State: | Enabled | |
| Cache Type: | Internal, Unified | |
| Cache Scheme: | Write-Through | |
| Supported SRAM Type: | Synchronous | |
| Current SRAM Type: | Synchronous | |
| Cache Speed: | Unknown | |
| Error Correction Type: | Single-bit ECC | |
| Maximum Cache Size: | 3072 KBytes | |
| Installed Cache Size: | 3072 KBytes | |
| Cache Associativity: | Unknown |
| L1 Cache |
| Socket Designation: | L1 Cache | |
| Cache State: | Enabled | |
| Cache Type: | Internal, Data | |
| Cache Scheme: | Write-Through | |
| Supported SRAM Type: | Synchronous | |
| Current SRAM Type: | Synchronous | |
| Cache Speed: | Unknown | |
| Error Correction Type: | Single-bit ECC | |
| Maximum Cache Size: | 32 KBytes | |
| Installed Cache Size: | 32 KBytes | |
| Cache Associativity: | 8-way Set-Associative |
| L2 Cache |
| Socket Designation: | L2 Cache | |
| Cache State: | Enabled | |
| Cache Type: | Internal, Unified | |
| Cache Scheme: | Write-Through | |
| Supported SRAM Type: | Synchronous | |
| Current SRAM Type: | Synchronous | |
| Cache Speed: | Unknown | |
| Error Correction Type: | Single-bit ECC | |
| Maximum Cache Size: | 256 KBytes | |
| Installed Cache Size: | 256 KBytes | |
| Cache Associativity: | 8-way Set-Associative |
| L1 Cache |
| Socket Designation: | L1 Cache | |
| Cache State: | Enabled | |
| Cache Type: | Internal, Instruction | |
| Cache Scheme: | Write-Through | |
| Supported SRAM Type: | Synchronous | |
| Current SRAM Type: | Synchronous | |
| Cache Speed: | Unknown | |
| Error Correction Type: | Single-bit ECC | |
| Maximum Cache Size: | 32 KBytes | |
| Installed Cache Size: | 32 KBytes | |
| Cache Associativity: | 4-way Set-Associative |
| Memory Devices |
| Physical Memory Array |
| Array Location: | System board | |
| Array Use: | System memory | |
| Error Detecting Method: | None | |
| Memory Capacity: | 8 GBytes | |
| Memory Devices: | 2 |
| Memory Device |
| Total Width: | 64 bits | |
| Data Width: | 64 bits | |
| Device Size: | 2048 MBytes | |
| Device Form Factor: | SODIMM | |
| Device Locator: | DIMM0 | |
| Bank Locator: | BANK 0 | |
| Device Type: | DDR3 SDRAM | |
| Device Type Detail: | Synchronous | |
| Memory Speed: | 1333 MHz | |
| Manufacturer: | Unknown | |
| Serial Number: | 66467EEC | |
| Part Number: | M471B5773CHS-CH9 | |
| Asset Tag: | Unknown |
| DIMM0 |
| Socket Designation: | DIMM0 | |
| Memory Type: | DIMM | |
| Memory Speed: | Unknown | |
| Installed size: | 2048 MBytes | |
| Enabled size: | 2048 MBytes |
| 32-bit Memory Error Information |
| Memory Device Mapped Address |
| Starting Address: | 00000000 | |
| Ending Address: | 001FFFFF | |
| Partition Row Position: | 2 | |
| Interleave Position: | 1 | |
| Interleave Data Depth: | 1 |
| Memory Device |
| Total Width: | 64 bits | |
| Data Width: | 64 bits | |
| Device Size: | 2048 MBytes | |
| Device Form Factor: | SODIMM | |
| Device Locator: | DIMM1 | |
| Bank Locator: | BANK 2 | |
| Device Type: | DDR3 SDRAM | |
| Device Type Detail: | Synchronous | |
| Memory Speed: | 1333 MHz | |
| Manufacturer: | Unknown | |
| Serial Number: | 00000000 | |
| Part Number: | ||
| Asset Tag: | Unknown |
| DIMM1 |
| Socket Designation: | DIMM1 | |
| Memory Type: | DIMM | |
| Memory Speed: | Unknown | |
| Installed size: | 2048 MBytes | |
| Enabled size: | 2048 MBytes |
| 32-bit Memory Error Information |
| Memory Device Mapped Address |
| Starting Address: | 00000000 | |
| Ending Address: | 001FFFFF | |
| Partition Row Position: | 2 | |
| Interleave Position: | 2 | |
| Interleave Data Depth: | 1 |
| 32-bit Memory Error Information |
| Memory Array Mapped Address |
| Starting Address: | 00000000 | |
| Ending Address: | 003FFFFF | |
| Partition Width: | 2 |
| Memory Controller |
| Error Detecting Method: | None | |
| Error Correction: | None | |
| Supported Interleave: | 1-Way | |
| Current Interleave: | 1-Way | |
| Max. Memory Module Size: | 8192 MBytes | |
| Supported Memory Speed: | ||
| Supported Memory Type: | ||
| Supported Memory Voltage: | ||
| Associated Memory Slots: | 2 |
| Port Connectors |
| USB |
| Port Type: | USB | |
| Internal Reference: | USB | |
| Internal Connector Type: | None | |
| External Reference: | USB 1 | |
| External Connector Type: | Access Bus (USB) |
| USB |
| Port Type: | USB | |
| Internal Reference: | USB | |
| Internal Connector Type: | None | |
| External Reference: | USB 2 | |
| External Connector Type: | Access Bus (USB) |
| Video Port |
| Port Type: | Video Port | |
| Internal Reference: | MONITOR | |
| Internal Connector Type: | None | |
| External Reference: | CRT | |
| External Connector Type: | DB-15 pin female |
| Network Port |
| Port Type: | Network Port | |
| Internal Reference: | Ethernet | |
| Internal Connector Type: | None | |
| External Reference: | ||
| External Connector Type: | RJ-45 |
| System Slots |
| J5C1 |
| Slot Designation: | J5C1 | |
| Slot Type: | PCI Express x16 | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 16x / x16 | |
| Slot Length: | Unknown |
| J6C1 |
| Slot Designation: | J6C1 | |
| Slot Type: | PCI Express x1 | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Unknown |
| J6C2 |
| Slot Designation: | J6C2 | |
| Slot Type: | PCI Express x1 | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Unknown |
| J6D2 |
| Slot Designation: | J6D2 | |
| Slot Type: | PCI Express x1 | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Unknown |
| J7C1 |
| Slot Designation: | J7C1 | |
| Slot Type: | PCI Express x1 | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Unknown |
| J7D2 |
| Slot Designation: | J7D2 | |
| Slot Type: | PCI Express x1 | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Unknown |
| J8C2 |
| Slot Designation: | J8C2 | |
| Slot Type: | PCI Express x16 | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 16x / x16 | |
| Slot Length: | Unknown |
| J8C1 |
| Slot Designation: | J8C1 | |
| Slot Type: | PCI Express x1 | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Unknown |
| Memory |
| [General information] | ||
| Total Memory Size: | 4 GBytes | |
| Total Memory Size [MB]: | 4096 | |
| [Current Performance Settings] | ||
| Maximum Supported Memory Clock: | 400.0 MHz | |
| Current Memory Clock: | 399.1 MHz (3 : 1 ratio) | |
| Current Timing (tCAS-tRCD-tRP-tRAS): | 6-6-6-15 | |
| Memory Runs At: | Dual-Channel | |
| Command Rate: | 1T | |
| Read to Read Delay (tRD_RD) Same Rank: | 4T | |
| Read to Read Delay (tRD_RD) Different Rank: | 7T | |
| Write to Write Delay (tWR_WR) Same Rank: | 4T | |
| Write to Write Delay (tWR_WR) Different Rank: | 7T | |
| Read to Write Delay (tRD_WR) Different Rank: | 8T | |
| Write to Read Delay (tWR_RD) Same Rank (tWTR): | 13T | |
| Write to Read Delay (tWR_RD) Different Rank: | 6T | |
| Read to Precharge Delay (tRTP): | 3T | |
| Write to Precharge Delay (tWTP): | 26T | |
| Write Recovery Time (tWR): | 15T | |
| RAS# to RAS# Delay (tRRD): | 4T | |
| Refresh Cycle Time (tRFC): | 64T | |
| Four Activate Window (tFAW): | 15T | |
| Row: 0 - 2 GB PC3-10600 DDR3 SDRAM Samsung M471B5773CHS-CH9 |
| [General Module Information] | ||
| Module Number: | 0 | |
| Module Size: | 2 GBytes | |
| Memory Type: | DDR3 SDRAM | |
| Module Type: | SO-DIMM | |
| Memory Speed: | 666.7 MHz (DDR3-1333 / PC3-10600) | |
| Module Manufacturer: | Samsung | |
| Module Part Number: | M471B5773CHS-CH9 | |
| Module Revision: | 0 | |
| Module Serial Number: | 3967698534 | |
| Module Manufacturing Date: | Year: 2011, Week: 32 | |
| Module Manufacturing Location: | 2 | |
| SDRAM Manufacturer: | Samsung | |
| Error Check/Correction: | None | |
| [Module characteristics] | ||
| Row Address Bits: | 15 | |
| Column Address Bits: | 10 | |
| Number Of Banks: | 8 | |
| Module Density: | 2048 Mb | |
| Number Of Ranks: | 1 | |
| Device Width: | 8 bits | |
| Bus Width: | 64 bits | |
| Module Nominal Voltage (VDD): | 1.5 V | |
| [Module timing] | ||
| Minimum SDRAM Cycle Time (tCKmin): | 1.500 ns | |
| CAS# Latencies Supported: | 5, 6, 7, 8, 9 | |
| Minimum CAS# Latency Time (tAAmin): | 13.125 ns | |
| Minimum RAS# to CAS# Delay (tRCDmin): | 13.125 ns | |
| Minimum Row Precharge Time (tRPmin): | 13.125 ns | |
| Minimum Active to Precharge Time (tRASmin): | 36.000 ns | |
| Supported Module Timing at 666.7 MHz: | 9-9-9-24 | |
| Supported Module Timing at 600.0 MHz: | 8-8-8-22 | |
| Supported Module Timing at 533.3 MHz: | 7-7-7-20 | |
| Supported Module Timing at 466.7 MHz: | 7-7-7-17 | |
| Supported Module Timing at 400.0 MHz: | 6-6-6-15 | |
| Supported Module Timing at 333.3 MHz: | 5-5-5-12 | |
| Minimum Write Recovery Time (tWRmin): | 15.000 ns | |
| Minimum Row Active to Row Active Delay (tRRDmin): | 6.000 ns | |
| Minimum Active to Active/Refresh Time (tRCmin): | 49.125 ns | |
| Minimum Refresh Recovery Time Delay (tRFCmin): | 160.000 ns | |
| Minimum Internal Write to Read Command Delay (tWTRmin): | 7.500 ns | |
| Minimum Internal Read to Precharge Command Delay (tRTPmin): | 7.500 ns | |
| Minimum Four Activate Window Delay Time (tFAWmin): | 30.000 ns | |
| [Features] | ||
| Partial Array Self Refresh (PASR): | Not Supported | |
| On-die Thermal Sensor (ODTS) Readout: | Not Supported | |
| Auto Self Refresh (ASR): | Not Supported | |
| Extended Temperature 1X Refresh Rate: | Not Supported | |
| Extended Temperature Range: | Supported | |
| Module Temperature Sensor: | Not Supported | |
| Pseudo Target Row Refresh (pTRR): | Not Supported | |
| Module Nominal Height: | 29 - 30 mm | |
| Module Maximum Thickness (Front): | 1 - 2 mm | |
| Module Maximum Thickness (Back): | 1 - 2 mm | |
| Row: 2 - 2 GB PC3-10600 DDR3 SDRAM Kingston |
| [General Module Information] | ||
| Module Number: | 2 | |
| Module Size: | 2 GBytes | |
| Memory Type: | DDR3 SDRAM | |
| Module Type: | SO-DIMM | |
| Memory Speed: | 666.7 MHz (DDR3-1333 / PC3-10600) | |
| Module Manufacturer: | Kingston | |
| Module Part Number: | ||
| Module Revision: | 0 | |
| Module Serial Number: | 0 | |
| Module Manufacturing Date: | Year: 2000, Week: 0 | |
| Module Manufacturing Location: | 0 | |
| SDRAM Manufacturer: | Unknown | |
| Error Check/Correction: | None | |
| [Module characteristics] | ||
| Row Address Bits: | 15 | |
| Column Address Bits: | 10 | |
| Number Of Banks: | 8 | |
| Module Density: | 2048 Mb | |
| Number Of Ranks: | 1 | |
| Device Width: | 8 bits | |
| Bus Width: | 64 bits | |
| Module Nominal Voltage (VDD): | 1.5 V | |
| [Module timing] | ||
| Minimum SDRAM Cycle Time (tCKmin): | 1.500 ns | |
| CAS# Latencies Supported: | 5, 6, 7, 8, 9 | |
| Minimum CAS# Latency Time (tAAmin): | 13.125 ns | |
| Minimum RAS# to CAS# Delay (tRCDmin): | 13.125 ns | |
| Minimum Row Precharge Time (tRPmin): | 13.125 ns | |
| Minimum Active to Precharge Time (tRASmin): | 36.000 ns | |
| Supported Module Timing at 666.7 MHz: | 9-9-9-24 | |
| Supported Module Timing at 600.0 MHz: | 8-8-8-22 | |
| Supported Module Timing at 533.3 MHz: | 7-7-7-20 | |
| Supported Module Timing at 466.7 MHz: | 7-7-7-17 | |
| Supported Module Timing at 400.0 MHz: | 6-6-6-15 | |
| Supported Module Timing at 333.3 MHz: | 5-5-5-12 | |
| Minimum Write Recovery Time (tWRmin): | 15.000 ns | |
| Minimum Row Active to Row Active Delay (tRRDmin): | 6.000 ns | |
| Minimum Active to Active/Refresh Time (tRCmin): | 49.125 ns | |
| Minimum Refresh Recovery Time Delay (tRFCmin): | 160.000 ns | |
| Minimum Internal Write to Read Command Delay (tWTRmin): | 7.500 ns | |
| Minimum Internal Read to Precharge Command Delay (tRTPmin): | 7.500 ns | |
| Minimum Four Activate Window Delay Time (tFAWmin): | 30.000 ns | |
| [Features] | ||
| Partial Array Self Refresh (PASR): | Supported | |
| On-die Thermal Sensor (ODTS) Readout: | Not Supported | |
| Auto Self Refresh (ASR): | Not Supported | |
| Extended Temperature 1X Refresh Rate: | Not Supported | |
| Extended Temperature Range: | Supported | |
| Module Temperature Sensor: | Not Supported | |
| Pseudo Target Row Refresh (pTRR): | Not Supported | |
| Module Nominal Height: | 29 - 30 mm | |
| Module Maximum Thickness (Front): | 1 - 2 mm | |
| Module Maximum Thickness (Back): | 1 - 2 mm | |
| Bus |
| PCI Bus #0 |
| Intel Auburndale/Arrandale Processor - Host Bridge/DRAM Controller |
| [General Information] | ||
| Device Name: | Intel Auburndale/Arrandale Processor - Host Bridge/DRAM Controller | |
| Original Device Name: | Intel Auburndale/Arrandale Processor - Host Bridge/DRAM Controller | |
| Device Class: | Host-to-PCI Bridge | |
| Revision ID: | 2 | |
| PCI Address (Bus:Device:Function) Number: | 0:0:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_0044&SUBSYS_04711028&REV_02 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Стандартные системные устройства) | |
| Driver Description: | Стандартный главный мост PCI — ЦП | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.15 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_0044&SUBSYS_04711028&REV_02\3&11583659&0&00 | |
| Location Paths | PCIROOT(0)#PCI(0000) | |
| Intel Auburndale/Arrandale Processor - Integrated Graphics Controller |
| [General Information] | ||
| Device Name: | Intel Auburndale/Arrandale Processor - Integrated Graphics Controller | |
| Original Device Name: | Intel Auburndale/Arrandale Processor - Integrated Graphics Controller | |
| Device Class: | VGA Compatible Adapter | |
| Revision ID: | 2 | |
| PCI Address (Bus:Device:Function) Number: | 0:2:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_0046&SUBSYS_04711028&REV_02 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | D0000000 | |
| Memory Base Address 2 | C0000000 | |
| I/O Base Address 4 | 2078 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) HD Graphics | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 8.15.10.2900 | |
| Driver Date: | 26-Nov-2012 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_0046&SUBSYS_04711028&REV_02\3&11583659&0&10 | |
| Location Paths | PCIROOT(0)#PCI(0200) | |
| Intel 5 Series/34x0 Chipset PCH - Host Embedded Controller Interface 1 (HECI1) [B3] |
| [General Information] | ||
| Device Name: | Intel 5 Series/34x0 Chipset PCH - Host Embedded Controller Interface 1 (HECI1) [B3] | |
| Original Device Name: | Intel 5 Series/34x0 Chipset PCH - Host Embedded Controller Interface 1 (HECI1) [B3] | |
| Device Class: | Unknown Communication Device | |
| Revision ID: | 6 [B3] | |
| PCI Address (Bus:Device:Function) Number: | 0:22:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_3B64&SUBSYS_04711028&REV_06 | |
| [System Resources] | ||
| Interrupt Line: | IRQ16 | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | D0607100 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel | |
| Driver Description: | Intel(R) Management Engine Interface | |
| Driver Provider: | Intel | |
| Driver Version: | 6.0.0.1179 | |
| Driver Date: | 17-Sep-2009 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_3B64&SUBSYS_04711028&REV_06\3&11583659&0&B0 | |
| Location Paths | PCIROOT(0)#PCI(1600) | |
| Intel 5 Series/34x0 Chipset PCH - USB 2.0 EHCI Controller #2 [B2] |
| [General Information] | ||
| Device Name: | Intel 5 Series/34x0 Chipset PCH - USB 2.0 EHCI Controller #2 [B2] | |
| Original Device Name: | Intel 5 Series/34x0 Chipset PCH - USB 2.0 EHCI Controller #2 [B2] | |
| Device Class: | USB EHCI Controller | |
| Revision ID: | 5 [B2] | |
| PCI Address (Bus:Device:Function) Number: | 0:26:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_3B3C&SUBSYS_04711028&REV_05 | |
| [System Resources] | ||
| Interrupt Line: | IRQ16 | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | D0606C00 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Capable | |
| USB Version Supported: | 2.0 | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel | |
| Driver Description: | Расширенный хост-контроллер Intel(R) 5 Series/3400 Series Chipset Family USB — 3B3C | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.15 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_3B3C&SUBSYS_04711028&REV_05\3&11583659&0&D0 | |
| Location Paths | PCIROOT(0)#PCI(1A00) | |
| USB Root Hub |
| [Port1] : Intel Integrated Rate Matching Hub |
| [Device Information] | ||
| Device Manufacturer: | Intel | |
| Product Name: | Intel Integrated Rate Matching Hub | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | Generic USB Hub | |
| Hardware ID: | USB\VID_8087&PID_0020 | |
| [Driver Information] | ||
| Driver Manufacturer: | (Generic USB Hub) | |
| Driver Description: | Generic USB Hub | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.15 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | USB\VID_8087&PID_0020\5&9B1B064&0&1 | |
| Location Paths | PCIROOT(0)#PCI(1A00)#USBROOT(0)#USB(1) | |
| [Port1] : RealTek RTS5138 USB Card Reader |
| [Device Information] | ||
| Device Manufacturer: | Generic | |
| Product Name: | USB2.0-CRW | |
| Serial Number: | 20090516388200000 | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | Запоминающее устройство для USB | |
| Hardware ID: | USB\VID_0BDA&PID_0138 | |
| [Driver Information] | ||
| Driver Manufacturer: | USB-совместимое запоминающее устройство | |
| Driver Description: | Запоминающее устройство для USB | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.15 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | USB\VID_0BDA&PID_0138\20090516388200000 | |
| Location Paths | PCIROOT(0)#PCI(1A00)#USBROOT(0)#USB(1)#USB(1) | |
| [Port2] : No Device Connected |
| [Port3] : No Device Connected |
| [Port4] : Составное USB устройство |
| [Device Information] | ||
| Device Manufacturer: | - | |
| Product Name: | - | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | Составное USB устройство | |
| Hardware ID: | USB\VID_174F&PID_143B | |
| [Driver Information] | ||
| Driver Manufacturer: | (Стандартный USB хост-контроллер) | |
| Driver Description: | Составное USB устройство | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.15 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | USB\VID_174F&PID_143B\200901010001 | |
| Location Paths | PCIROOT(0)#PCI(1A00)#USBROOT(0)#USB(1)#USB(4) | |
| [Port5] : No Device Connected |
| [Port6] : No Device Connected |
| [Port2] : No Device Connected |
| [Port3] : No Device Connected |
| Intel 5 Series/34x0 Chipset PCH - High Definition Audio Controller [B2] |
| [General Information] | ||
| Device Name: | Intel 5 Series/34x0 Chipset PCH - High Definition Audio Controller [B2] | |
| Original Device Name: | Intel 5 Series/34x0 Chipset PCH - High Definition Audio Controller [B2] | |
| Device Class: | Mixed mode device | |
| Revision ID: | 5 [B2] | |
| PCI Address (Bus:Device:Function) Number: | 0:27:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_3B56&SUBSYS_04711028&REV_05 | |
| [PCI Express] | ||
| Version: | 1.1 | |
| Current Link Width: | Not negotiated | |
| Device/Port Type: | Root Complex Integrated Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | None | |
| Active State Power Management (ASPM) Status: | Disabled | |
| L0s Exit Latency: | < 64 ns | |
| L1 Exit Latency: | < 1 us | |
| Maximum Payload Size Supported: | 128 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | IRQ22 | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | D0600000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Microsoft | |
| Driver Description: | Контроллер High Definition Audio (Microsoft) | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.15 | |
| Driver Date: | 28-Sep-2017 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_3B56&SUBSYS_04711028&REV_05\3&11583659&0&D8 | |
| Location Paths | PCIROOT(0)#PCI(1B00) | |
| Intel 5 Series/34x0 Chipset PCH - PCI Express Root Port #1 [B2] |
| [General Information] | ||
| Device Name: | Intel 5 Series/34x0 Chipset PCH - PCI Express Root Port #1 [B2] | |
| Original Device Name: | Intel 5 Series/34x0 Chipset PCH - PCI Express Root Port #1 [B2] | |
| Device Class: | PCI-to-PCI Bridge | |
| Revision ID: | 5 [B2] | |
| PCI Address (Bus:Device:Function) Number: | 0:28:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_3B42&SUBSYS_00000000&REV_05 | |
| [PCI Express] | ||
| Version: | 1.1 | |
| Maximum Link Width: | 1x | |
| Current Link Width: | 1x | |
| Maximum Link Speed: | 2.5 GT/s | |
| Current Link Speed: | 2.5 GT/s | |
| Device/Port Type: | Root Port of PCI Express Root Complex | |
| Slot Implemented: | Yes | |
| Hot-Plug: | Capable | |
| Hot-Plug Surprise: | Capable | |
| Slot Power Limit: | 10.000 W | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L0s and L1 | |
| Active State Power Management (ASPM) Status: | L1 Entry | |
| L0s Exit Latency: | 128 - 256 ns | |
| L1 Exit Latency: | 2 - 4 us | |
| Maximum Payload Size Supported: | 128 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Стандартные системные устройства) | |
| Driver Description: | Мост PCI–PCI | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.125 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_3B42&SUBSYS_04711028&REV_05\3&11583659&0&E0 | |
| Location Paths | PCIROOT(0)#PCI(1C00) | |
| PCI Express x1 Bus #1 |
| Qualcomm/Atheros AR8132 PCI-E Fast Ethernet Controller (L2c) |
| [General Information] | ||
| Device Name: | Qualcomm/Atheros AR8132 PCI-E Fast Ethernet Controller (L2c) | |
| Original Device Name: | Qualcomm/Atheros AR8132 PCI-E Fast Ethernet Controller (L2c) | |
| Device Class: | Ethernet Adapter | |
| Revision ID: | C0 | |
| PCI Address (Bus:Device:Function) Number: | 1:0:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_1969&DEV_1062&SUBSYS_04711028&REV_C0 | |
| [PCI Express] | ||
| Version: | 1.1 | |
| Maximum Link Width: | 1x | |
| Current Link Width: | 1x | |
| Maximum Link Speed: | 2.5 GT/s | |
| Current Link Speed: | 2.5 GT/s | |
| Device/Port Type: | PCI Express Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L0s and L1 | |
| Active State Power Management (ASPM) Status: | L1 Entry | |
| L0s Exit Latency: | >4 us | |
| L1 Exit Latency: | >64 us | |
| Maximum Payload Size Supported: | 4096 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | IRQ16 | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | D0500000 | |
| I/O Base Address 2 | EF80 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Qualcomm Atheros | |
| Driver Description: | Qualcomm Atheros AR8132 PCI-E Fast Ethernet Controller (NDIS 6.30) | |
| Driver Provider: | Microsoft | |
| Driver Version: | 2.1.0.16 | |
| Driver Date: | 01-Apr-2013 | |
| DeviceInstanceId | PCI\VEN_1969&DEV_1062&SUBSYS_04711028&REV_C0\4&1EFD7F79&0&00E0 | |
| Location Paths | PCIROOT(0)#PCI(1C00)#PCI(0000) | |
| Intel 5 Series/34x0 Chipset PCH - PCI Express Root Port #2 [B2] |
| [General Information] | ||
| Device Name: | Intel 5 Series/34x0 Chipset PCH - PCI Express Root Port #2 [B2] | |
| Original Device Name: | Intel 5 Series/34x0 Chipset PCH - PCI Express Root Port #2 [B2] | |
| Device Class: | PCI-to-PCI Bridge | |
| Revision ID: | 5 [B2] | |
| PCI Address (Bus:Device:Function) Number: | 0:28:1 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_3B44&SUBSYS_00000000&REV_05 | |
| [PCI Express] | ||
| Version: | 1.1 | |
| Maximum Link Width: | 1x | |
| Current Link Width: | 1x | |
| Maximum Link Speed: | 2.5 GT/s | |
| Current Link Speed: | 2.5 GT/s | |
| Device/Port Type: | Root Port of PCI Express Root Complex | |
| Slot Implemented: | Yes | |
| Hot-Plug: | Capable | |
| Hot-Plug Surprise: | Capable | |
| Slot Power Limit: | 10.000 W | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L0s and L1 | |
| Active State Power Management (ASPM) Status: | L1 Entry | |
| L0s Exit Latency: | 128 - 256 ns | |
| L1 Exit Latency: | 2 - 4 us | |
| Maximum Payload Size Supported: | 128 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTB# | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Стандартные системные устройства) | |
| Driver Description: | Мост PCI–PCI | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.125 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_3B44&SUBSYS_04711028&REV_05\3&11583659&0&E1 | |
| Location Paths | PCIROOT(0)#PCI(1C01) | |
| PCI Express x1 Bus #2 |
| Intel Centrino Advanced-N 6250 AGN 2x2 HMC |
| [General Information] | ||
| Device Name: | Intel Centrino Advanced-N 6250 AGN 2x2 HMC | |
| Original Device Name: | Intel Centrino Advanced-N 6250 (Kilmer Peak) 2x2 HMC WiFi/WiMAX Adapter | |
| Device Class: | Unknown Network Adapter | |
| Revision ID: | 5E | |
| PCI Address (Bus:Device:Function) Number: | 2:0:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_0087&SUBSYS_13218086&REV_5E | |
| [PCI Express] | ||
| Version: | 1.1 | |
| Maximum Link Width: | 1x | |
| Current Link Width: | 1x | |
| Maximum Link Speed: | 2.5 GT/s | |
| Current Link Speed: | 2.5 GT/s | |
| Device/Port Type: | PCI Express Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L0s and L1 | |
| Active State Power Management (ASPM) Status: | L1 Entry | |
| L0s Exit Latency: | 64 - 128 ns | |
| L1 Exit Latency: | 16 - 32 us | |
| Maximum Payload Size Supported: | 128 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | D0400000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) Centrino(R) Advanced-N 6250 AGN | |
| Driver Provider: | Microsoft | |
| Driver Version: | 15.12.0.8 | |
| Driver Date: | 17-Nov-2014 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_0087&SUBSYS_13218086&REV_5E\4&2E94DFD9&0&00E1 | |
| Location Paths | PCIROOT(0)#PCI(1C01)#PCI(0000) | |
| Intel 5 Series/34x0 Chipset PCH - USB 2.0 EHCI Controller #1 [B2] |
| [General Information] | ||
| Device Name: | Intel 5 Series/34x0 Chipset PCH - USB 2.0 EHCI Controller #1 [B2] | |
| Original Device Name: | Intel 5 Series/34x0 Chipset PCH - USB 2.0 EHCI Controller #1 [B2] | |
| Device Class: | USB EHCI Controller | |
| Revision ID: | 5 [B2] | |
| PCI Address (Bus:Device:Function) Number: | 0:29:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_3B34&SUBSYS_04711028&REV_05 | |
| [System Resources] | ||
| Interrupt Line: | IRQ23 | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | D0606800 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Capable | |
| USB Version Supported: | 2.0 | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel | |
| Driver Description: | Расширенный хост-контроллер Intel(R) 5 Series/3400 Series Chipset Family USB — 3B34 | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.15 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_3B34&SUBSYS_04711028&REV_05\3&11583659&0&E8 | |
| Location Paths | PCIROOT(0)#PCI(1D00) | |
| USB Root Hub |
| [Port1] : Intel Integrated Rate Matching Hub |
| [Device Information] | ||
| Device Manufacturer: | Intel | |
| Product Name: | Intel Integrated Rate Matching Hub | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | Generic USB Hub | |
| Hardware ID: | USB\VID_8087&PID_0020 | |
| [Driver Information] | ||
| Driver Manufacturer: | (Generic USB Hub) | |
| Driver Description: | Generic USB Hub | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.15 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | USB\VID_8087&PID_0020\5&20476A6A&0&1 | |
| Location Paths | PCIROOT(0)#PCI(1D00)#USBROOT(0)#USB(1) | |
| [Port1] : No Device Connected |
| [Port2] : Alcor Micro USB Flash Drive |
| [Device Information] | ||
| Device Manufacturer: | Alcor Micro | |
| Product Name: | Mass Storage Device | |
| Serial Number: | N/A | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | Запоминающее устройство для USB | |
| Hardware ID: | USB\VID_058F&PID_9380 | |
| [Driver Information] | ||
| Driver Manufacturer: | USB-совместимое запоминающее устройство | |
| Driver Description: | Запоминающее устройство для USB | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.15 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | USB\VID_058F&PID_9380\6&24104126&0&2 | |
| Location Paths | PCIROOT(0)#PCI(1D00)#USBROOT(0)#USB(1)#USB(2) | |
| [Port3] : No Device Connected |
| [Port4] : No Device Connected |
| [Port5] : Intel WiMAX 6250 Adapter |
| [Device Information] | ||
| Device Manufacturer: | Intel | |
| Product Name: | Intel WiMAX 6250 Adapter | |
| Serial Number: | ||
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | ||
| Hardware ID: | USB\VID_8086&PID_0188 | |
| [Port6] : Unknown Device Connected |
| [Device Information] | ||
| Device Manufacturer: | DELL | |
| Product Name: | ||
| Serial Number: | ||
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | ||
| Hardware ID: | USB\VID_413C&PID_8185 | |
| [Port7] : No Device Connected |
| [Port8] : No Device Connected |
| [Port2] : No Device Connected |
| [Port3] : No Device Connected |
| Intel 82801xxM Mobile I/O Controller Hub |
| [General Information] | ||
| Device Name: | Intel 82801xxM Mobile I/O Controller Hub | |
| Original Device Name: | Intel 82801xxM Mobile I/O Controller Hub | |
| Device Class: | PCI-to-PCI Bridge | |
| Revision ID: | A5 | |
| PCI Address (Bus:Device:Function) Number: | 0:30:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_2448&SUBSYS_00000000&REV_A5 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Стандартные системные устройства) | |
| Driver Description: | Мост PCI–PCI | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.125 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_2448&SUBSYS_04711028&REV_A5\3&11583659&0&F0 | |
| Location Paths | PCIROOT(0)#PCI(1E00) | |
| [ICH Configuration] | ||
| High Priority PCI: | Disabled | |
| 15-16MB Hole: | Disabled | |
| Discard Timer Mode [ICH2]: | 128 PCICLKs (4 us) | |
| 32-Clock Retry [ICH2]/12-Clock Retry [ICH3/4]: | Disabled | |
| [Multi-Transaction Timer] | ||
| Multi-Transaction Timer Count Value: | 0 PCICLKs | |
| [Error Command] | ||
| SERR# On Target Abort Receive: | Disabled | |
| SERR# On Delayed Transaction Timeout: | Disabled | |
| PCI Bus #3 |
| Intel HM57 Express Chipset - LPC Interface Controller [B2] |
| [General Information] | ||
| Device Name: | Intel HM57 Express Chipset - LPC Interface Controller [B2] | |
| Original Device Name: | Intel HM57 Express Chipset - LPC Interface Controller [B2] | |
| Device Class: | PCI-to-ISA Bridge | |
| Revision ID: | 5 [B2] | |
| PCI Address (Bus:Device:Function) Number: | 0:31:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_3B0B&SUBSYS_04711028&REV_05 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel | |
| Driver Description: | Контроллер LPC | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.15 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_3B0B&SUBSYS_04711028&REV_05\3&11583659&0&F8 | |
| Location Paths | PCIROOT(0)#PCI(1F00) | |
| Intel 5 Series Chipset-M PCH - SATA AHCI 6-port Controller [B2] |
| [General Information] | ||
| Device Name: | Intel 5 Series Chipset-M PCH - SATA AHCI 6-port Controller [B2] | |
| Original Device Name: | Intel 5 Series Chipset-M PCH - SATA AHCI 6-port Controller [B2] | |
| Device Class: | SATA AHCI Controller | |
| Revision ID: | 5 [B2] | |
| PCI Address (Bus:Device:Function) Number: | 0:31:2 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_3B2F&SUBSYS_04711028&REV_05 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTB# | |
| I/O Base Address 0 | 2058 | |
| I/O Base Address 1 | 2084 | |
| I/O Base Address 2 | 2050 | |
| I/O Base Address 3 | 2080 | |
| I/O Base Address 4 | 2020 | |
| Memory Base Address 5 | D0606000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Capable | |
| Fast Back-to-Back Transactions: | Capable | |
| [SATA Host Controller] | ||
| Interface Speed Supported: | Gen2 3.0 Gbps | |
| Number Of Ports: | 6 | |
| External SATA Support: | Not Capable | |
| Aggressive Link Power Management: | Capable | |
| Staggered Spin-up: | Not Capable | |
| Mechanical Presence Switch: | Capable | |
| Command Queue Acceleration: | Capable | |
| 64-bit Addressing: | Capable | |
| AHCI Status: | Enabled | |
| AHCI Version: | 1.30 | |
| Ports Implemented: | 0 | |
| [SATA Port#0] | ||
| Port Status: | Device Present, Phy communication not established | |
| Current Interface Speed: | Gen2 3.0 Gbps | |
| External SATA Port: | Not Capable | |
| Hot Plug: | Not Capable | |
| Device Type: | SATA | |
| [Driver Information] | ||
| Driver Manufacturer: | Стандартный контроллер SATA AHCI | |
| Driver Description: | Стандартный контроллер SATA AHCI | |
| Driver Provider: | Майкрософт | |
| Driver Version: | 10.0.16299.98 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_3B2F&SUBSYS_04711028&REV_05\3&11583659&0&FA | |
| Location Paths | PCIROOT(0)#PCI(1F02) | |
| Intel 5 Series/34x0 Chipset PCH - SMBus Controller [B2] |
| [General Information] | ||
| Device Name: | Intel 5 Series/34x0 Chipset PCH - SMBus Controller [B2] | |
| Original Device Name: | Intel 5 Series/34x0 Chipset PCH - SMBus Controller [B2] | |
| Device Class: | SMBus (System Management Bus) | |
| Revision ID: | 5 [B2] | |
| PCI Address (Bus:Device:Function) Number: | 0:31:3 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_3B30&SUBSYS_04711028&REV_05 | |
| [System Resources] | ||
| Interrupt Line: | IRQ10 | |
| Interrupt Pin: | INTC# | |
| Memory Base Address 0 | D0607000 | |
| I/O Base Address 4 | 2000 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel | |
| Driver Description: | Контроллер модуля виртуализации | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.15 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_3B30&SUBSYS_04711028&REV_05\3&11583659&0&FB | |
| Location Paths | PCIROOT(0)#PCI(1F03) | |
| Intel 5 Series/34x0 Chipset PCH - Thermal Sensor [B2] |
| [General Information] | ||
| Device Name: | Intel 5 Series/34x0 Chipset PCH - Thermal Sensor [B2] | |
| Original Device Name: | Intel 5 Series/34x0 Chipset PCH - Thermal Sensor [B2] | |
| Device Class: | Unknown Data Acquisition/Signal Processing Controller | |
| Revision ID: | 5 [B2] | |
| PCI Address (Bus:Device:Function) Number: | 0:31:6 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_3B32&SUBSYS_04711028&REV_05 | |
| [System Resources] | ||
| Interrupt Line: | IRQ11 | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | D0604000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel | |
| Driver Description: | Устройство управления термическим состоянием | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.15 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_3B32&SUBSYS_04711028&REV_05\3&11583659&0&FE | |
| Location Paths | PCIROOT(0)#PCI(1F06) | |
| PCI Bus #255 |
| Intel QuickPath Architecture - Generic Non-core (Uncore) Registers |
| [General Information] | ||
| Device Name: | Intel QuickPath Architecture - Generic Non-core (Uncore) Registers | |
| Original Device Name: | Intel QuickPath Architecture - Generic Non-core (Uncore) Registers | |
| Device Class: | Host-to-PCI Bridge | |
| Revision ID: | 2 | |
| PCI Address (Bus:Device:Function) Number: | 255:0:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_2C62&SUBSYS_04711028&REV_02 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Стандартные системные устройства) | |
| Driver Description: | Стандартный главный мост PCI — ЦП | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.15 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_2C62&SUBSYS_04711028&REV_02\3&4F11E61&0&00 | |
| Location Paths | PCIROOT(FF)#PCI(0000) | |
| Intel QuickPath Architecture - System Address Decoder (SAD) |
| [General Information] | ||
| Device Name: | Intel QuickPath Architecture - System Address Decoder (SAD) | |
| Original Device Name: | Intel QuickPath Architecture - System Address Decoder (SAD) | |
| Device Class: | Host-to-PCI Bridge | |
| Revision ID: | 2 | |
| PCI Address (Bus:Device:Function) Number: | 255:0:1 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_2D01&SUBSYS_04711028&REV_02 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Стандартные системные устройства) | |
| Driver Description: | Стандартный главный мост PCI — ЦП | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.15 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_2D01&SUBSYS_04711028&REV_02\3&4F11E61&0&01 | |
| Location Paths | PCIROOT(FF)#PCI(0001) | |
| Intel QuickPath Interconnect - QPI Link 0 Control |
| [General Information] | ||
| Device Name: | Intel QuickPath Interconnect - QPI Link 0 Control | |
| Original Device Name: | Intel QuickPath Interconnect - QPI Link 0 Control | |
| Device Class: | Host-to-PCI Bridge | |
| Revision ID: | 2 | |
| PCI Address (Bus:Device:Function) Number: | 255:2:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_2D10&SUBSYS_04711028&REV_02 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Стандартные системные устройства) | |
| Driver Description: | Стандартный главный мост PCI — ЦП | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.15 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_2D10&SUBSYS_04711028&REV_02\3&4F11E61&0&10 | |
| Location Paths | PCIROOT(FF)#PCI(0200) | |
| Intel QuickPath Interconnect - QPI Physical 0 Control |
| [General Information] | ||
| Device Name: | Intel QuickPath Interconnect - QPI Physical 0 Control | |
| Original Device Name: | Intel QuickPath Interconnect - QPI Physical 0 Control | |
| Device Class: | Host-to-PCI Bridge | |
| Revision ID: | 2 | |
| PCI Address (Bus:Device:Function) Number: | 255:2:1 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_2D11&SUBSYS_04711028&REV_02 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Стандартные системные устройства) | |
| Driver Description: | Стандартный главный мост PCI — ЦП | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.15 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_2D11&SUBSYS_04711028&REV_02\3&4F11E61&0&11 | |
| Location Paths | PCIROOT(FF)#PCI(0201) | |
| Intel QuickPath Interconnect - QPI (FDI?) |
| [General Information] | ||
| Device Name: | Intel QuickPath Interconnect - QPI (FDI?) | |
| Original Device Name: | Intel QuickPath Interconnect - QPI (FDI?) | |
| Device Class: | Host-to-PCI Bridge | |
| Revision ID: | 2 | |
| PCI Address (Bus:Device:Function) Number: | 255:2:2 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_2D12&SUBSYS_04711028&REV_02 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Стандартные системные устройства) | |
| Driver Description: | Стандартный главный мост PCI — ЦП | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.15 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_2D12&SUBSYS_04711028&REV_02\3&4F11E61&0&12 | |
| Location Paths | PCIROOT(FF)#PCI(0202) | |
| Intel QuickPath Interconnect - QPI (FDI?) |
| [General Information] | ||
| Device Name: | Intel QuickPath Interconnect - QPI (FDI?) | |
| Original Device Name: | Intel QuickPath Interconnect - QPI (FDI?) | |
| Device Class: | Host-to-PCI Bridge | |
| Revision ID: | 2 | |
| PCI Address (Bus:Device:Function) Number: | 255:2:3 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_2D13&SUBSYS_04711028&REV_02 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Стандартные системные устройства) | |
| Driver Description: | Стандартный главный мост PCI — ЦП | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.15 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_2D13&SUBSYS_04711028&REV_02\3&4F11E61&0&13 | |
| Location Paths | PCIROOT(FF)#PCI(0203) | |
| Video Adapter |
| Intel HD Graphics |
| [Video chipset] | ||
| Video Chipset: | Intel HD Graphics | |
| Video Chipset Codename: | Ironlake | |
| Video Memory: | 1305526 KBytes | |
| [Video Card] | ||
| Video Card: | Intel Auburndale/Arrandale Processor - Integrated Graphics Controller [DELL] | |
| Video Bus: | Integrated | |
| Video RAMDAC: | Internal | |
| Video BIOS Version: | 2086 PC 14.34 10/14/2010 20:34:22 | |
| [Performance] | ||
| Processor Clock: | 166.7 MHz | |
| Hardware ID: | PCI\VEN_8086&DEV_0046&SUBSYS_04711028&REV_02 | |
| PCI Location (Bus:Dev:Fnc): | 0:02:0 | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) HD Graphics | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 8.15.10.2900 | |
| Driver Date: | 26-Nov-2012 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_0046&SUBSYS_04711028&REV_02\3&11583659&0&10 | |
| Location Paths | PCIROOT(0)#PCI(0200) | |
| Monitor |
| Chi Mei [Unknown Model: CMO1111] |
| [General information] | ||
| Monitor Name: | Chi Mei [Unknown Model: CMO1111] | |
| Monitor Name (Manuf): | N116B6 [DELL P/N: HF9D2] | |
| Serial Number: | Unknown | |
| Date Of Manufacture: | Week: 24, Year: 2010 | |
| Monitor Hardware ID: | Monitor\CMO1111 | |
| Max. Vertical Size: | 14 cm | |
| Max. Horizontal Size: | 25 cm | |
| [Advanced parameters] | ||
| Input Signal: | Digital | |
| Color Bit Depth: | 6 Bits per Primary Color | |
| Display Type: | RGB color | |
| Gamma Factor: | 2.20 | |
| [DPMS Modes] | ||
| Standby: | Not Supported | |
| Suspend: | Not Supported | |
| Active Off: | Not Supported | |
| Standard Colour Space: | Not Supported | |
| Preferred Timing Mode: | Supported | |
| Default GTF Supported: | Not Supported | |
| DFP 1.x Compatible: | No | |
| [Supported Video Modes] | ||
| 1366 x 768 | 256 x 144 mm, Pixel Clock 69.30 MHz | |
| Drives |
| (S)ATA/ATAPI Drives |
| WDC WD2500BEVT-75A23T0 |
| [General Information] | ||
| Drive Controller: | Serial ATA 3Gb/s | |
| Drive Model: | WDC WD2500BEVT-75A23T0 | |
| Drive Firmware Revision: | 01.01A01 | |
| Drive Serial Number: | WD-WXA1A9172130 | |
| World Wide Name: | 50014EE6AC6A86FE | |
| Drive Capacity: | 238,475 MBytes (250 GB) | |
| Drive Capacity [MB]: | 238475 | |
| Media Rotation Rate: | 5400 RPM | |
| ATA Major Version Supported: | ATA/ATAPI-5, ATA/ATAPI-6, ATA/ATAPI-7, ATA8-ACS | |
| ATA Transport Version Supported: | SATA 2.6 | |
| [Drive Geometry] | ||
| Number of Cylinders: | 16383 | |
| Number of Heads: | 16 | |
| Sectors Per Track: | 63 | |
| Number Of ECC Bytes: | 50 | |
| Number of Sectors: | 16514064 | |
| Total 32-bit LBA Sectors: | 268435455 | |
| Total 48-bit LBA Sectors: | 488397168 | |
| Logical Sector Size: | 512 Bytes | |
| Cache Buffer Size: | 8192 KBytes | |
| [Transfer Modes] | ||
| Sectors Per Interrupt: | Total: 16, Active: 0 | |
| Max. PIO Transfer Mode: | 4 | |
| Multiword DMA Mode: | Total: 2, Active: - | |
| Singleword DMA Mode: | Total: -, Active: - | |
| Ultra-DMA Mode: | Total: 6 (ATA-133), Active: 6 (ATA-133) | |
| Max. Multiword DMA Transfer Rate: | 16.7 MBytes/s | |
| Max. PIO with IORDY Transfer Rate: | 16.7 MBytes/s | |
| Max. PIO w/o IORDY Transfer Rate: | 16.7 MBytes/s | |
| Transfer Width: | 16-bit | |
| Native Command Queuing: | Supported, Max. Depth: 32 | |
| TRIM Command: | Not Supported | |
| [Device flags] | ||
| Fixed Drive: | Present | |
| Removable Drive: | Not Present | |
| Magnetic Storage: | Present | |
| LBA Mode: | Supported | |
| DMA Mode: | Supported | |
| IORDY: | Supported | |
| IORDY Disableable: | Supported | |
| [Features] | ||
| Write Cache: | Present, Active | |
| S.M.A.R.T. Feature: | Present, Active | |
| Security Feature: | Present, Inactive | |
| Removable Media Feature: | Not Present, Disabled | |
| Power Management: | Present, Active | |
| Advanced Power Management: | Present, Active | |
| Packet Interface: | Not Present, Disabled | |
| Look-Ahead Buffer: | Present, Active | |
| Host Protected Area: | Present, Enabled | |
| Power-Up In Standby: | Not Suppported, Inactive | |
| Automatic Acoustic Management: | Not Suppported, Inactive | |
| 48-bit LBA: | Supported, Active | |
| Host-Initiated Link Power Management: | Supported | |
| Device-Initiated Link Power Management: | Supported, Disabled | |
| In-Order Data Delivery: | Not Supported | |
| Hardware Feature Control: | Not Supported | |
| Software Settings Preservation: | Supported, Enabled | |
| NCQ Autosense: | Not Supported | |
| Link Power State Device Sleep: | Not Supported | |
| Hybrid Information Feature: | Not Supported | |
| Rebuild Assist: | Not Supported | |
| Power Disable: | Not Supported | |
| All Write Cache Non-Volatile: | Not Supported | |
| Extended Number of User Addressable Sectors: | Not Supported | |
| CFast Specification: | Not Supported | |
| NCQ Priority Information: | Supported | |
| Host Automatic Partial to Slumber Transitions: | Not Supported | |
| Device Automatic Partial to Slumber Transitions: | Not Supported | |
| NCQ Streaming: | Not Supported | |
| NCQ Queue Management Command: | Not Supported | |
| DevSleep to Reduced Power State: | Not Supported | |
| Extended Power Conditions Feature: | Not Supported | |
| Sense Data Reporting Feature: | Not Supported | |
| Free-Fall Control Feature: | Not Supported | |
| Write-Read-Verify Feature: | Not Supported | |
| [Security] | ||
| Security Feature: | Supported | |
| Security Status: | Disabled | |
| Security Locked: | Disabled | |
| Security Frozen: | Enabled | |
| Enhanced Security Erase: | Supported | |
| Sanitize Feature: | Not Supported | |
| Sanitize Device - Crypto Scramble: | Not Supported | |
| Sanitize Device - Overwrite: | Not Supported | |
| Sanitize Device - Block Erase: | Not Supported | |
| Sanitize Device - Antifreeze Lock: | Not Supported | |
| Device Encrypts All User Data: | Not Supported | |
| Trusted Computing: | Not Supported | |
| [Self-Monitoring, Analysis and Reporting Technology (S.M.A.R.T.)] | ||
| [01] Raw Read Error Rate: | 200/51, Worst: 200 | |
| [03] Spin Up Time: | 159/21, Worst: 147 (Data = 1033,0) | |
| [04] Start/Stop Count: | 98/Always OK, Worst: 98 (Data = 2002,0) | |
| [05] Reallocated Sector Count: | 200/140, Worst: 200 | |
| [07] Seek Error Rate: | 100/Always OK, Worst: 253 | |
| [09] Power-On Hours/Cycle Count: | 1/Always OK, Worst: 1 (77044 hours / 8.79 years) | |
| [0A] Spin Retry Count: | 100/Always OK, Worst: 100 | |
| [0B] Calibration Retry Count: | 100/Always OK, Worst: 100 | |
| [0C] Power Cycle Count: | 99/Always OK, Worst: 99 (Data = 1970,0) | |
| [BF] G-Sense Error Rate: | 1/Always OK, Worst: 1 (Data = 495,0) | |
| [C0] Power-Off Retract Count: | 200/Always OK, Worst: 200 (Data = 112,0) | |
| [C1] Load/Unload Cycle Count: | 144/Always OK, Worst: 144 (Data = 169121,0) | |
| [C2] Temperature | 108/Always OK, Worst: 91 (35.0 °C) | |
| [C4] Reallocation Event Count: | 200/Always OK, Worst: 200 | |
| [C5] Current Pending Sector Count: | 200/Always OK, Worst: 200 | |
| [C6] Off-Line Uncorrectable Sector Count: | 100/Always OK, Worst: 253 | |
| [C7] UltraDMA/SATA CRC Error Rate: | 200/Always OK, Worst: 200 | |
| [C8] Write/Multi-Zone Error Rate: | 100/Always OK, Worst: 253 | |
| [F0] Head Flying Hours: | 99/Always OK, Worst: 99 (Data = 1081,0) | |
| [F1] Lifetime Writes from Host (LBAs Written): | 200/Always OK, Worst: 200 (Data = 1269179058,1) | |
| [F2] Lifetime Reads from Host (LBAs Read): | 200/Always OK, Worst: 200 (Data = 1527688113,1) | |
| [FE] Free Fall Protection: | 200/Always OK, Worst: 200 | |
| Audio |
| Intel 5 Series/34x0 Chipset PCH - High Definition Audio Controller [B2] |
| Audio Adapter: | Intel 5 Series/34x0 Chipset PCH - High Definition Audio Controller [B2] | |
| Audio Controller Hardware ID: | PCI\VEN_8086&DEV_3B56&SUBSYS_04711028&REV_05 | |
| High Definition Audio Codec: | RealTek ALC269 | |
| Audio Codec Hardware ID: | HDAUDIO\FUNC_01&VEN_10EC&DEV_0269&SUBSYS_00000000 | |
| [Driver Information] | ||
| Driver Manufacturer: | Microsoft | |
| Driver Description: | Устройство с поддержкой High Definition Audio | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.15 | |
| Driver Date: | 28-Sep-2017 | |
| DeviceInstanceId | HDAUDIO\FUNC_01&VEN_10EC&DEV_0269&SUBSYS_10280471&REV_1001\4&59A3CD1&0&0001 | |
| Network |
| Qualcomm/Atheros AR8132 PCI-E Fast Ethernet Controller (L2c) |
| [General information] | ||
| Network Card: | Qualcomm/Atheros AR8132 PCI-E Fast Ethernet Controller (L2c) | |
| Vendor Description: | Qualcomm Atheros Ar81xx series PCI-E Ethernet Controller | |
| MAC Address: | D4-BE-D9-05-EE-CC | |
| [Capabilities] | ||
| Maximum Link Speed: | 100 Mbps | |
| Transmit Buffer Size: | 389632 Bytes | |
| Receive Buffer Size: | 779264 Bytes | |
| Hardware ID: | PCI\VEN_1969&DEV_1062&SUBSYS_04711028&REV_C0 | |
| [Driver Information] | ||
| Driver Manufacturer: | Qualcomm Atheros | |
| Driver Description: | Qualcomm Atheros AR8132 PCI-E Fast Ethernet Controller (NDIS 6.30) | |
| Driver Provider: | Microsoft | |
| Driver Version: | 2.1.0.16 | |
| Driver Date: | 01-Apr-2013 | |
| DeviceInstanceId | PCI\VEN_1969&DEV_1062&SUBSYS_04711028&REV_C0\4&1EFD7F79&0&00E0 | |
| Location Paths | PCIROOT(0)#PCI(1C00)#PCI(0000) | |
| Intel Centrino Advanced-N 6250 AGN 2x2 HMC |
| [General information] | ||
| Network Card: | Intel Centrino Advanced-N 6250 AGN 2x2 HMC | |
| Vendor Description: | Microsoft | |
| MAC Address: | 64-80-99-45-CB-34 | |
| [Capabilities] | ||
| Maximum Link Speed: | 300 Mbps | |
| Transmit Buffer Size: | 6201344 Bytes | |
| Receive Buffer Size: | 6201344 Bytes | |
| Hardware ID: | PCI\VEN_8086&DEV_0087&SUBSYS_13218086&REV_5E | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) Centrino(R) Advanced-N 6250 AGN | |
| Driver Provider: | Microsoft | |
| Driver Version: | 15.12.0.8 | |
| Driver Date: | 17-Nov-2014 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_0087&SUBSYS_13218086&REV_5E\4&2E94DFD9&0&00E1 | |
| Location Paths | PCIROOT(0)#PCI(1C01)#PCI(0000) | |
| Ports |
| Serial Ports |
| Parallel Ports |
| USB |
| Расширенный хост-контроллер Intel(R) 5 Series/3400 Series Chipset Family USB — 3B34 |
| Root Hub |
| [Port1] : Intel Integrated Rate Matching Hub |
| [Device Information] | ||
| Device Manufacturer: | Intel | |
| Product Name: | Intel Integrated Rate Matching Hub | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | Generic USB Hub | |
| Hardware ID: | USB\VID_8087&PID_0020 | |
| [Driver Information] | ||
| Driver Manufacturer: | (Generic USB Hub) | |
| Driver Description: | Generic USB Hub | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.15 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | USB\VID_8087&PID_0020\5&20476A6A&0&1 | |
| Location Paths | PCIROOT(0)#PCI(1D00)#USBROOT(0)#USB(1) | |
| [Port1] : No Device Connected |
| [Port2] : Alcor Micro USB Flash Drive |
| [Device Information] | ||
| Device Manufacturer: | Alcor Micro | |
| Product Name: | Mass Storage Device | |
| Serial Number: | N/A | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | Запоминающее устройство для USB | |
| Hardware ID: | USB\VID_058F&PID_9380 | |
| [Driver Information] | ||
| Driver Manufacturer: | USB-совместимое запоминающее устройство | |
| Driver Description: | Запоминающее устройство для USB | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.15 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | USB\VID_058F&PID_9380\6&24104126&0&2 | |
| Location Paths | PCIROOT(0)#PCI(1D00)#USBROOT(0)#USB(1)#USB(2) | |
| [Port3] : No Device Connected |
| [Port4] : No Device Connected |
| [Port5] : Intel WiMAX 6250 Adapter |
| [Device Information] | ||
| Device Manufacturer: | Intel | |
| Product Name: | Intel WiMAX 6250 Adapter | |
| Serial Number: | ||
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | ||
| Hardware ID: | USB\VID_8086&PID_0188 | |
| [Port6] : Unknown Device Connected |
| [Device Information] | ||
| Device Manufacturer: | DELL | |
| Product Name: | ||
| Serial Number: | ||
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | ||
| Hardware ID: | USB\VID_413C&PID_8185 | |
| [Port7] : No Device Connected |
| [Port8] : No Device Connected |
| [Port2] : No Device Connected |
| [Port3] : No Device Connected |
| Расширенный хост-контроллер Intel(R) 5 Series/3400 Series Chipset Family USB — 3B3C |
| Root Hub |
| [Port1] : Intel Integrated Rate Matching Hub |
| [Device Information] | ||
| Device Manufacturer: | Intel | |
| Product Name: | Intel Integrated Rate Matching Hub | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | Generic USB Hub | |
| Hardware ID: | USB\VID_8087&PID_0020 | |
| [Driver Information] | ||
| Driver Manufacturer: | (Generic USB Hub) | |
| Driver Description: | Generic USB Hub | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.15 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | USB\VID_8087&PID_0020\5&9B1B064&0&1 | |
| Location Paths | PCIROOT(0)#PCI(1A00)#USBROOT(0)#USB(1) | |
| [Port1] : RealTek RTS5138 USB Card Reader |
| [Device Information] | ||
| Device Manufacturer: | Generic | |
| Product Name: | USB2.0-CRW | |
| Serial Number: | 20090516388200000 | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | Запоминающее устройство для USB | |
| Hardware ID: | USB\VID_0BDA&PID_0138 | |
| [Driver Information] | ||
| Driver Manufacturer: | USB-совместимое запоминающее устройство | |
| Driver Description: | Запоминающее устройство для USB | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.15 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | USB\VID_0BDA&PID_0138\20090516388200000 | |
| Location Paths | PCIROOT(0)#PCI(1A00)#USBROOT(0)#USB(1)#USB(1) | |
| [Port2] : No Device Connected |
| [Port3] : No Device Connected |
| [Port4] : Составное USB устройство |
| [Device Information] | ||
| Device Manufacturer: | - | |
| Product Name: | - | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | Составное USB устройство | |
| Hardware ID: | USB\VID_174F&PID_143B | |
| [Driver Information] | ||
| Driver Manufacturer: | (Стандартный USB хост-контроллер) | |
| Driver Description: | Составное USB устройство | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.15 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | USB\VID_174F&PID_143B\200901010001 | |
| Location Paths | PCIROOT(0)#PCI(1A00)#USBROOT(0)#USB(1)#USB(4) | |
| [Port5] : No Device Connected |
| [Port6] : No Device Connected |
| [Port2] : No Device Connected |
| [Port3] : No Device Connected |
| Smart Battery |
| Battery #0 |
| [General Properties] | ||
| Device Name: | DELL R6G71183 | |
| Manufacturer Name: | Dynapack | |
| Serial Number: | 041B | |
| Unique ID: | 041BDynapackDELL R6G71183 | |
| Chemistry: | ||
| Designed Capacity: | 56000 mWh | |
| Full Charged Capacity: | 27250 mWh | |
| Wear Level: | 51.3 % | |
| [Current Power Status] | ||
| Power Status: | Discharging | |
| Current Capacity: | 2720 mWh (10.0 %) | |
| Current Voltage: | 10.582 V | |
| Discharge Rate: | -11756 mW | |